C15H21HgN5O6 — CID 139033150
1,3-dimethyl-7H-purine-2,6-dione;[3-(2,5-dioxopyrrolidin-1-yl)-2-methoxypropyl]mercury(1+);hydroxide (PubChem CID 139033150) has the molecular formula C15H21HgN5O6 and a molecular weight of 567.95 g/mol. Its IUPAC name is 1,3-dimethyl-7H-purine-2,6-dione;[3-(2,5-dioxopyrrolidin-1-yl)-2-methoxypropyl]mercury(1+);hydroxide.
| Compound Name | 1,3-dimethyl-7H-purine-2,6-dione;[3-(2,5-dioxopyrrolidin-1-yl)-2-methoxypropyl]mercury(1+);hydroxide |
|---|---|
| PubChem CID | 139033150 |
| Molecular Formula | C15H21HgN5O6 |
| Molecular Weight | 567.95 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 1,3-dimethyl-7H-purine-2,6-dione;[3-(2,5-dioxopyrrolidin-1-yl)-2-methoxypropyl]mercury(1+);hydroxide |
| SMILES | COC(C[Hg+])CN1C(=O)CCC1=O.Cn1c(=O)c2[nH]cnc2n(C)c1=O.[OH-] |
| InChI | InChI=1S/C8H12NO3.C7H8N4O2.Hg.H2O/c1-6(12-2)5-9-7(10)3-4-8(9)11;1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;;/h6H,1,3-5H2,2H3;3H,1-2H3,(H,8,9);;1H2/q;;+1;/p-1 |
| InChIKey | VNXGUMNUIITWSL-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.95 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|