C9H15N5O3 — CID 11311
2-aminoethanol;1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 11311) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-aminoethanol;1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 2-aminoethanol;1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11311 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-aminoethanol;1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]cnc2n(C)c1=O.NCCO |
| InChI | InChI=1S/C7H8N4O2.C2H7NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h3H,1-2H3,(H,8,9);4H,1-3H2 |
| InChIKey | DAAFJZUNCOXSKD-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |