C21H20ClN3O4 — CID 139034303
3-[2-[[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]methyl]pyrrolidin-1-yl]benzoic acid (PubChem CID 139034303) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is 3-[2-[[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]methyl]pyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[2-[[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]methyl]pyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 139034303 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-[2-[[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]methyl]pyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2CCCC2CC2NC(=O)N(c3cccc(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C21H20ClN3O4/c22-14-5-2-7-17(11-14)25-19(26)18(23-21(25)29)12-16-8-3-9-24(16)15-6-1-4-13(10-15)20(27)28/h1-2,4-7,10-11,16,18H,3,8-9,12H2,(H,23,29)(H,27,28) |
| InChIKey | CQYIKWAQHVCFMB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|