C10H15N3O — CID 139036221
2-(3-but-3-ynyldiazirin-3-yl)-N-propan-2-ylacetamide (PubChem CID 139036221) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(3-but-3-ynyldiazirin-3-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(3-but-3-ynyldiazirin-3-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 139036221 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-(3-but-3-ynyldiazirin-3-yl)-N-propan-2-ylacetamide |
| SMILES | C#CCCC1(CC(=O)NC(C)C)N=N1 |
| InChI | InChI=1S/C10H15N3O/c1-4-5-6-10(12-13-10)7-9(14)11-8(2)3/h1,8H,5-7H2,2-3H3,(H,11,14) |
| InChIKey | HTRFUYKPMQDOCF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|