C17H27N5O3 — CID 146152971
1-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-methoxypyrrolidin-3-yl]-3-propan-2-ylurea (PubChem CID 146152971) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-methoxypyrrolidin-3-yl]-3-propan-2-ylurea.
| Compound Name | 1-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-methoxypyrrolidin-3-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 146152971 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 1-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-methoxypyrrolidin-3-yl]-3-propan-2-ylurea |
| SMILES | C#CCCC1(CCC(=O)N2CC(NC(=O)NC(C)C)C(OC)C2)N=N1 |
| InChI | InChI=1S/C17H27N5O3/c1-5-6-8-17(20-21-17)9-7-15(23)22-10-13(14(11-22)25-4)19-16(24)18-12(2)3/h1,12-14H,6-11H2,2-4H3,(H2,18,19,24) |
| InChIKey | ZHBUBAXIULEHDF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|