C18H25N3O4 — CID 166418217
methyl 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-8-oxa-1-azaspiro[4.5]decane-3-carboxylate (PubChem CID 166418217) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is methyl 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-8-oxa-1-azaspiro[4.5]decane-3-carboxylate.
| Compound Name | methyl 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-8-oxa-1-azaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 166418217 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | methyl 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-8-oxa-1-azaspiro[4.5]decane-3-carboxylate |
| SMILES | C#CCCC1(CCC(=O)N2CC(C(=O)OC)CC23CCOCC3)N=N1 |
| InChI | InChI=1S/C18H25N3O4/c1-3-4-6-18(19-20-18)7-5-15(22)21-13-14(16(23)24-2)12-17(21)8-10-25-11-9-17/h1,14H,4-13H2,2H3 |
| InChIKey | LMSXPLAFAYFWJU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|