C14H18O7 — CID 139036672
methyl (1S,4aR,7aS)-1,7a-diacetyloxy-4a,5,6,7-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate (PubChem CID 139036672) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is methyl (1S,4aR,7aS)-1,7a-diacetyloxy-4a,5,6,7-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1S,4aR,7aS)-1,7a-diacetyloxy-4a,5,6,7-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 139036672 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl (1S,4aR,7aS)-1,7a-diacetyloxy-4a,5,6,7-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OC(C)=O)[C@]2(OC(C)=O)CCC[C@H]12 |
| InChI | InChI=1S/C14H18O7/c1-8(15)20-13-14(21-9(2)16)6-4-5-11(14)10(7-19-13)12(17)18-3/h7,11,13H,4-6H2,1-3H3/t11-,13+,14+/m1/s1 |
| InChIKey | GCNKYFJKMIHASK-XBFCOCLRSA-N |
| XLogP | 1.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|