C14H20O4 — CID 10083563
[(3aR,4aR,8aR,8bS)-4a-hydroxy-4-oxo-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[a]inden-8b-yl] acetate (PubChem CID 10083563) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(3aR,4aR,8aR,8bS)-4a-hydroxy-4-oxo-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[a]inden-8b-yl] acetate.
| Compound Name | [(3aR,4aR,8aR,8bS)-4a-hydroxy-4-oxo-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[a]inden-8b-yl] acetate |
|---|---|
| PubChem CID | 10083563 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [(3aR,4aR,8aR,8bS)-4a-hydroxy-4-oxo-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclopenta[a]inden-8b-yl] acetate |
| SMILES | CC(=O)O[C@]12CCC[C@H]1C(=O)[C@@]1(O)CCCC[C@@H]21 |
| InChI | InChI=1S/C14H20O4/c1-9(15)18-14-8-4-5-10(14)12(16)13(17)7-3-2-6-11(13)14/h10-11,17H,2-8H2,1H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | HGWXDONQHVGOJW-OIMNJJJWSA-N |
| XLogP | 1.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |