C35H38ClNO2 — CID 139037142
dibenzyl-[(1S,2S,3S,4S)-3,4-diphenyl-2-propan-2-yloxycarbonylcyclopentyl]azanium chloride (PubChem CID 139037142) has the molecular formula C35H38ClNO2 and a molecular weight of 540.15 g/mol. Its IUPAC name is dibenzyl-[(1S,2S,3S,4S)-3,4-diphenyl-2-propan-2-yloxycarbonylcyclopentyl]azanium chloride.
| Compound Name | dibenzyl-[(1S,2S,3S,4S)-3,4-diphenyl-2-propan-2-yloxycarbonylcyclopentyl]azanium chloride |
|---|---|
| PubChem CID | 139037142 |
| Molecular Formula | C35H38ClNO2 |
| Molecular Weight | 540.15 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | dibenzyl-[(1S,2S,3S,4S)-3,4-diphenyl-2-propan-2-yloxycarbonylcyclopentyl]azanium chloride |
| SMILES | CC(C)OC(=O)[C@H]1[C@@H](c2ccccc2)[C@@H](c2ccccc2)C[C@@H]1[NH+](Cc1ccccc1)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C35H37NO2.ClH/c1-26(2)38-35(37)34-32(36(24-27-15-7-3-8-16-27)25-28-17-9-4-10-18-28)23-31(29-19-11-5-12-20-29)33(34)30-21-13-6-14-22-30;/h3-22,26,31-34H,23-25H2,1-2H3;1H/t31-,32+,33+,34-;/m1./s1 |
| InChIKey | YSTCHUXOBFNIPP-RHDSLRIASA-N |
| XLogP | 3.18 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.15 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |