C23H37NO2 — CID 53234209
2,4-dimethylpentan-3-yl (3S)-3-(benzylamino)-3-cyclohexylpropanoate (PubChem CID 53234209) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl (3S)-3-(benzylamino)-3-cyclohexylpropanoate.
| Compound Name | 2,4-dimethylpentan-3-yl (3S)-3-(benzylamino)-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 53234209 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 2,4-dimethylpentan-3-yl (3S)-3-(benzylamino)-3-cyclohexylpropanoate |
| SMILES | CC(C)C(OC(=O)C[C@H](NCc1ccccc1)C1CCCCC1)C(C)C |
| InChI | InChI=1S/C23H37NO2/c1-17(2)23(18(3)4)26-22(25)15-21(20-13-9-6-10-14-20)24-16-19-11-7-5-8-12-19/h5,7-8,11-12,17-18,20-21,23-24H,6,9-10,13-16H2,1-4H3/t21-/m0/s1 |
| InChIKey | ZXJZKGOBXMCABJ-NRFANRHFSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |