C14H20O2S — CID 139037193
3-[(2S,3S)-3-phenylsulfanyloxan-2-yl]propan-1-ol (PubChem CID 139037193) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 3-[(2S,3S)-3-phenylsulfanyloxan-2-yl]propan-1-ol.
| Compound Name | 3-[(2S,3S)-3-phenylsulfanyloxan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 139037193 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-[(2S,3S)-3-phenylsulfanyloxan-2-yl]propan-1-ol |
| SMILES | OCCC[C@@H]1OCCC[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C14H20O2S/c15-10-4-8-13-14(9-5-11-16-13)17-12-6-2-1-3-7-12/h1-3,6-7,13-15H,4-5,8-11H2/t13-,14-/m0/s1 |
| InChIKey | RGYNWCSJXLCQAI-KBPBESRZSA-N |
| XLogP | 3.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |