C51H59N3O7P2 — CID 139037229
bis(tert-butyl N-[(R)-diphenylphosphoryl(phenyl)methyl]carbamate);N,N-dimethylformamide (PubChem CID 139037229) has the molecular formula C51H59N3O7P2 and a molecular weight of 888.00 g/mol. Its IUPAC name is bis(tert-butyl N-[(R)-diphenylphosphoryl(phenyl)methyl]carbamate);N,N-dimethylformamide.
| Compound Name | bis(tert-butyl N-[(R)-diphenylphosphoryl(phenyl)methyl]carbamate);N,N-dimethylformamide |
|---|---|
| PubChem CID | 139037229 |
| Molecular Formula | C51H59N3O7P2 |
| Molecular Weight | 888.00 g/mol |
| Exact Mass | 887.38 |
| IUPAC Name | bis(tert-butyl N-[(R)-diphenylphosphoryl(phenyl)methyl]carbamate);N,N-dimethylformamide |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccccc1)P(=O)(c1ccccc1)c1ccccc1.CC(C)(C)OC(=O)N[C@@H](c1ccccc1)P(=O)(c1ccccc1)c1ccccc1.CN(C)C=O |
| InChI | InChI=1S/2C24H26NO3P.C3H7NO/c2*1-24(2,3)28-23(26)25-22(19-13-7-4-8-14-19)29(27,20-15-9-5-10-16-20)21-17-11-6-12-18-21;1-4(2)3-5/h2*4-18,22H,1-3H3,(H,25,26);3H,1-2H3/t2*22-;/m11./s1 |
| InChIKey | BQKUPPXWJHUJBS-LJWMURKVSA-N |
| XLogP | 10.15 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.00 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|