C30H44N2O6P2 — CID 139037559
(4S)-5,5-dimethyl-3-[methyl(phenyl)phosphoryl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 139037559) has the molecular formula C30H44N2O6P2 and a molecular weight of 590.64 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-3-[methyl(phenyl)phosphoryl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-5,5-dimethyl-3-[methyl(phenyl)phosphoryl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139037559 |
| Molecular Formula | C30H44N2O6P2 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | (4S)-5,5-dimethyl-3-[methyl(phenyl)phosphoryl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1N([P@](C)(=O)c2ccccc2)C(=O)OC1(C)C.CC(C)[C@@H]1N([P@](C)(=O)c2ccccc2)C(=O)OC1(C)C |
| InChI | InChI=1S/2C15H22NO3P/c2*1-11(2)13-15(3,4)19-14(17)16(13)20(5,18)12-9-7-6-8-10-12/h2*6-11,13H,1-5H3/t2*13-,20+/m00/s1 |
| InChIKey | DWDACLAHTOITIK-SEZRZQLLSA-N |
| XLogP | 6.95 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|