C15H22NO3P — CID 56934436
(4S)-5,5-dimethyl-3-[methyl(phenyl)phosphoryl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 56934436) has the molecular formula C15H22NO3P and a molecular weight of 295.32 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-3-[methyl(phenyl)phosphoryl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-5,5-dimethyl-3-[methyl(phenyl)phosphoryl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 56934436 |
| Molecular Formula | C15H22NO3P |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (4S)-5,5-dimethyl-3-[methyl(phenyl)phosphoryl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1N([P@](C)(=O)c2ccccc2)C(=O)OC1(C)C |
| InChI | InChI=1S/C15H22NO3P/c1-11(2)13-15(3,4)19-14(17)16(13)20(5,18)12-9-7-6-8-10-12/h6-11,13H,1-5H3/t13-,20+/m0/s1 |
| InChIKey | KIWQDVZQWLGESH-RNODOKPDSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|