C16H22NO4P — CID 11359186
tert-butyl (2R,4S)-5-oxo-2-phenyl-4-propan-2-yl-1,3,2-oxazaphospholidine-3-carboxylate (PubChem CID 11359186) has the molecular formula C16H22NO4P and a molecular weight of 323.33 g/mol. Its IUPAC name is tert-butyl (2R,4S)-5-oxo-2-phenyl-4-propan-2-yl-1,3,2-oxazaphospholidine-3-carboxylate.
| Compound Name | tert-butyl (2R,4S)-5-oxo-2-phenyl-4-propan-2-yl-1,3,2-oxazaphospholidine-3-carboxylate |
|---|---|
| PubChem CID | 11359186 |
| Molecular Formula | C16H22NO4P |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | tert-butyl (2R,4S)-5-oxo-2-phenyl-4-propan-2-yl-1,3,2-oxazaphospholidine-3-carboxylate |
| SMILES | CC(C)[C@H]1C(=O)O[P@](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22NO4P/c1-11(2)13-14(18)21-22(12-9-7-6-8-10-12)17(13)15(19)20-16(3,4)5/h6-11,13H,1-5H3/t13-,22+/m0/s1 |
| InChIKey | OEEJBTKTJRDHID-WHEQGISXSA-N |
| XLogP | 3.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|