C13H16NO4P — CID 11242984
tert-butyl (2R)-5-oxo-2-phenyl-1,3,2-oxazaphospholidine-3-carboxylate (PubChem CID 11242984) has the molecular formula C13H16NO4P and a molecular weight of 281.25 g/mol. Its IUPAC name is tert-butyl (2R)-5-oxo-2-phenyl-1,3,2-oxazaphospholidine-3-carboxylate.
| Compound Name | tert-butyl (2R)-5-oxo-2-phenyl-1,3,2-oxazaphospholidine-3-carboxylate |
|---|---|
| PubChem CID | 11242984 |
| Molecular Formula | C13H16NO4P |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | tert-butyl (2R)-5-oxo-2-phenyl-1,3,2-oxazaphospholidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)O[P@]1c1ccccc1 |
| InChI | InChI=1S/C13H16NO4P/c1-13(2,3)17-12(16)14-9-11(15)18-19(14)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3/t19-/m1/s1 |
| InChIKey | JDPINMFFXAFRAO-LJQANCHMSA-N |
| XLogP | 2.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|