C14H18NO4P — CID 11358366
tert-butyl (2R,4S)-4-methyl-5-oxo-2-phenyl-1,3,2-oxazaphospholidine-3-carboxylate (PubChem CID 11358366) has the molecular formula C14H18NO4P and a molecular weight of 295.27 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-methyl-5-oxo-2-phenyl-1,3,2-oxazaphospholidine-3-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-methyl-5-oxo-2-phenyl-1,3,2-oxazaphospholidine-3-carboxylate |
|---|---|
| PubChem CID | 11358366 |
| Molecular Formula | C14H18NO4P |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | tert-butyl (2R,4S)-4-methyl-5-oxo-2-phenyl-1,3,2-oxazaphospholidine-3-carboxylate |
| SMILES | C[C@H]1C(=O)O[P@](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H18NO4P/c1-10-12(16)19-20(11-8-6-5-7-9-11)15(10)13(17)18-14(2,3)4/h5-10H,1-4H3/t10-,20+/m0/s1 |
| InChIKey | GYAGOAFAWPIEII-WVDJIFEKSA-N |
| XLogP | 2.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|