C36H56O6 — CID 139037636
(4aR,4bS,7S,8aS,10aS)-2,7-dihydroxy-1,4b,7,10a-tetramethyl-4,4a,5,6,8,8a,9,10-octahydrophenanthren-3-one (PubChem CID 139037636) has the molecular formula C36H56O6 and a molecular weight of 584.84 g/mol. Its IUPAC name is (4aR,4bS,7S,8aS,10aS)-2,7-dihydroxy-1,4b,7,10a-tetramethyl-4,4a,5,6,8,8a,9,10-octahydrophenanthren-3-one.
| Compound Name | (4aR,4bS,7S,8aS,10aS)-2,7-dihydroxy-1,4b,7,10a-tetramethyl-4,4a,5,6,8,8a,9,10-octahydrophenanthren-3-one |
|---|---|
| PubChem CID | 139037636 |
| Molecular Formula | C36H56O6 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | (4aR,4bS,7S,8aS,10aS)-2,7-dihydroxy-1,4b,7,10a-tetramethyl-4,4a,5,6,8,8a,9,10-octahydrophenanthren-3-one |
| SMILES | CC1=C(O)C(=O)C[C@@H]2[C@@]3(C)CC[C@](C)(O)C[C@@H]3CC[C@]12C.CC1=C(O)C(=O)C[C@@H]2[C@@]3(C)CC[C@](C)(O)C[C@@H]3CC[C@]12C |
| InChI | InChI=1S/2C18H28O3/c2*1-11-15(20)13(19)9-14-17(11,3)6-5-12-10-16(2,21)7-8-18(12,14)4/h2*12,14,20-21H,5-10H2,1-4H3/t2*12-,14-,16-,17+,18-/m00/s1 |
| InChIKey | BMIQITHZMDBFIG-AORMWVHYSA-N |
| XLogP | 7.53 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |