C20H30O4 — CID 162947704
(4aS,4bR,7R,8aR,10aR)-7-(2-hydroxyacetyl)-1-(hydroxymethylidene)-4b,7,10a-trimethyl-4,4a,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 162947704) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (4aS,4bR,7R,8aR,10aR)-7-(2-hydroxyacetyl)-1-(hydroxymethylidene)-4b,7,10a-trimethyl-4,4a,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | (4aS,4bR,7R,8aR,10aR)-7-(2-hydroxyacetyl)-1-(hydroxymethylidene)-4b,7,10a-trimethyl-4,4a,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 162947704 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (4aS,4bR,7R,8aR,10aR)-7-(2-hydroxyacetyl)-1-(hydroxymethylidene)-4b,7,10a-trimethyl-4,4a,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | C[C@@]1(C(=O)CO)CC[C@]2(C)[C@H](CC[C@@]3(C)C(=CO)C(=O)CC[C@@H]23)C1 |
| InChI | InChI=1S/C20H30O4/c1-18(17(24)12-22)8-9-19(2)13(10-18)6-7-20(3)14(11-21)15(23)4-5-16(19)20/h11,13,16,21-22H,4-10,12H2,1-3H3/t13-,16+,18-,19-,20+/m1/s1 |
| InChIKey | VMABUJQSXCDKJR-MKCULMFZSA-N |
| XLogP | 3.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|