C19H30O — CID 10492588
(1aR,3aR,5S,7bS)-1a,3a,5,7b-tetramethyl-1b,2,3,5,6,7,7a,8,9,9a-decahydro-1H-cyclopropa[a]phenanthren-4-one (PubChem CID 10492588) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1aR,3aR,5S,7bS)-1a,3a,5,7b-tetramethyl-1b,2,3,5,6,7,7a,8,9,9a-decahydro-1H-cyclopropa[a]phenanthren-4-one.
| Compound Name | (1aR,3aR,5S,7bS)-1a,3a,5,7b-tetramethyl-1b,2,3,5,6,7,7a,8,9,9a-decahydro-1H-cyclopropa[a]phenanthren-4-one |
|---|---|
| PubChem CID | 10492588 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1aR,3aR,5S,7bS)-1a,3a,5,7b-tetramethyl-1b,2,3,5,6,7,7a,8,9,9a-decahydro-1H-cyclopropa[a]phenanthren-4-one |
| SMILES | C[C@H]1CCC2[C@@]3(C)CCC4C[C@@]4(C)C3CC[C@@]2(C)C1=O |
| InChI | InChI=1S/C19H30O/c1-12-5-6-14-17(2)9-7-13-11-19(13,4)15(17)8-10-18(14,3)16(12)20/h12-15H,5-11H2,1-4H3/t12-,13?,14?,15?,17+,18+,19+/m0/s1 |
| InChIKey | TVQXHCNUERIPLR-DMYKMZRDSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |