C29H46O2 — CID 162803091
(1S,2S,5S,6S,11S,14S,15R,18S,19S)-6,10,10,14,20,20-hexamethyl-21-oxahexacyclo[17.3.2.01,18.02,15.05,14.06,11]tetracosan-22-one (PubChem CID 162803091) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (1S,2S,5S,6S,11S,14S,15R,18S,19S)-6,10,10,14,20,20-hexamethyl-21-oxahexacyclo[17.3.2.01,18.02,15.05,14.06,11]tetracosan-22-one.
| Compound Name | (1S,2S,5S,6S,11S,14S,15R,18S,19S)-6,10,10,14,20,20-hexamethyl-21-oxahexacyclo[17.3.2.01,18.02,15.05,14.06,11]tetracosan-22-one |
|---|---|
| PubChem CID | 162803091 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (1S,2S,5S,6S,11S,14S,15R,18S,19S)-6,10,10,14,20,20-hexamethyl-21-oxahexacyclo[17.3.2.01,18.02,15.05,14.06,11]tetracosan-22-one |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CC[C@H]4[C@@H](CC[C@H]5[C@@H]6CC[C@]45C(=O)OC6(C)C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C29H46O2/c1-25(2)14-7-15-28(6)22(25)13-16-27(5)19-8-9-20-18-12-17-29(20,21(19)10-11-23(27)28)24(30)31-26(18,3)4/h18-23H,7-17H2,1-6H3/t18-,19+,20-,21-,22-,23-,27-,28-,29+/m0/s1 |
| InChIKey | AIPVGUVDLVEVFN-JDBDVTBCSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |