C27H46BO2 — CID 154675666
CID 154675666 (PubChem CID 154675666) has the molecular formula C27H46BO2 and a molecular weight of 413.48 g/mol.
| Compound Name | CID 154675666 |
|---|---|
| PubChem CID | 154675666 |
| Molecular Formula | C27H46BO2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.36 |
| IUPAC Name | — |
| SMILES | CCCCC([B][C@@H]1C[C@H]2[C@]3(C)CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]2(C)C1=O)CC |
| InChI | InChI=1S/C27H46BO2/c1-6-8-9-19(7-2)28-21-17-23-26(4)13-10-18-16-20(29)11-14-25(18,3)22(26)12-15-27(23,5)24(21)30/h18-23,29H,6-17H2,1-5H3/t18-,19?,20-,21+,22+,23-,25-,26+,27-/m0/s1 |
| InChIKey | PYIQPUOIYQLKDD-QDRGORLXSA-N |
| XLogP | 6.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|