C27H49N3O2 — CID 121382604
(3S,8S,10S,13S,17R)-8,17-diamino-10,13-dimethyl-17-[(2S)-2-nitrosooctan-2-yl]-2,3,4,5,6,7,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 121382604) has the molecular formula C27H49N3O2 and a molecular weight of 447.71 g/mol. Its IUPAC name is (3S,8S,10S,13S,17R)-8,17-diamino-10,13-dimethyl-17-[(2S)-2-nitrosooctan-2-yl]-2,3,4,5,6,7,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,10S,13S,17R)-8,17-diamino-10,13-dimethyl-17-[(2S)-2-nitrosooctan-2-yl]-2,3,4,5,6,7,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 121382604 |
| Molecular Formula | C27H49N3O2 |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 447.38 |
| IUPAC Name | (3S,8S,10S,13S,17R)-8,17-diamino-10,13-dimethyl-17-[(2S)-2-nitrosooctan-2-yl]-2,3,4,5,6,7,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCCCCC[C@](C)(N=O)[C@@]1(N)CCC2[C@]3(N)CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H49N3O2/c1-5-6-7-8-13-25(4,30-32)27(29)17-12-22-24(27,3)15-11-21-23(2)14-10-20(31)18-19(23)9-16-26(21,22)28/h19-22,31H,5-18,28-29H2,1-4H3/t19?,20-,21?,22?,23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | QAQIVCLWPQZZII-DTUVMJIISA-N |
| XLogP | 5.66 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|