C28H50O3 — CID 144955617
(6S,9S)-17-[(2S)-2-hydroxyoctan-2-yl]-6-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 144955617) has the molecular formula C28H50O3 and a molecular weight of 434.71 g/mol. Its IUPAC name is (6S,9S)-17-[(2S)-2-hydroxyoctan-2-yl]-6-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (6S,9S)-17-[(2S)-2-hydroxyoctan-2-yl]-6-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 144955617 |
| Molecular Formula | C28H50O3 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.38 |
| IUPAC Name | (6S,9S)-17-[(2S)-2-hydroxyoctan-2-yl]-6-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCCCCC[C@](C)(O)C1CCC2C3C[C@H](OC)C4CC(O)CCC4(C)[C@H]3CCC21C |
| InChI | InChI=1S/C28H50O3/c1-6-7-8-9-14-28(4,30)25-11-10-21-20-18-24(31-5)23-17-19(29)12-15-26(23,2)22(20)13-16-27(21,25)3/h19-25,29-30H,6-18H2,1-5H3/t19?,20?,21?,22-,23?,24-,25?,26?,27?,28-/m0/s1 |
| InChIKey | AUOOPWBQCYWSHJ-XULIQCTCSA-N |
| XLogP | 6.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|