C21H36O3 — CID 78318686
(3S,5R,6S,8R,9R,10S,13S,14R,16R)-6,16-dimethoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 78318686) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (3S,5R,6S,8R,9R,10S,13S,14R,16R)-6,16-dimethoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,6S,8R,9R,10S,13S,14R,16R)-6,16-dimethoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 78318686 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (3S,5R,6S,8R,9R,10S,13S,14R,16R)-6,16-dimethoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CO[C@@H]1C[C@@H]2[C@H]3C[C@H](OC)[C@@H]4C[C@@H](O)CC[C@@]4(C)[C@@H]3CC[C@@]2(C)C1 |
| InChI | InChI=1S/C21H36O3/c1-20-7-6-16-15(17(20)10-14(12-20)23-3)11-19(24-4)18-9-13(22)5-8-21(16,18)2/h13-19,22H,5-12H2,1-4H3/t13-,14+,15-,16+,17+,18-,19-,20-,21-/m0/s1 |
| InChIKey | WYUYIZGBJLYKJM-CXAIKJKASA-N |
| XLogP | 4.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |