C27H48O3 — CID 163910147
(1R,4S,5S,7S,10R,14R)-15-[(2S)-2-hydroxyoctan-2-yl]-10-methyltetracyclo[12.3.1.02,11.05,10]octadecane-4,7-diol (PubChem CID 163910147) has the molecular formula C27H48O3 and a molecular weight of 420.68 g/mol. Its IUPAC name is (1R,4S,5S,7S,10R,14R)-15-[(2S)-2-hydroxyoctan-2-yl]-10-methyltetracyclo[12.3.1.02,11.05,10]octadecane-4,7-diol.
| Compound Name | (1R,4S,5S,7S,10R,14R)-15-[(2S)-2-hydroxyoctan-2-yl]-10-methyltetracyclo[12.3.1.02,11.05,10]octadecane-4,7-diol |
|---|---|
| PubChem CID | 163910147 |
| Molecular Formula | C27H48O3 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.36 |
| IUPAC Name | (1R,4S,5S,7S,10R,14R)-15-[(2S)-2-hydroxyoctan-2-yl]-10-methyltetracyclo[12.3.1.02,11.05,10]octadecane-4,7-diol |
| SMILES | CCCCCC[C@](C)(O)C1CC[C@@H]2C[C@H]1CCC1C2C[C@H](O)[C@H]2C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C27H48O3/c1-4-5-6-7-13-27(3,30)22-10-8-18-15-19(22)9-11-23-21(18)17-25(29)24-16-20(28)12-14-26(23,24)2/h18-25,28-30H,4-17H2,1-3H3/t18-,19-,20+,21?,22?,23?,24-,25+,26-,27+/m1/s1 |
| InChIKey | QRIQMVZCPYOURG-XNKIORASSA-N |
| XLogP | 5.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|