C32H55NO5 — CID 140930200
[(3S,5S,6S,10R,13S,17S)-3-hydroxy-17-[(2S)-2-hydroxyoctan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] 4-(methylamino)-4-oxobutanoate (PubChem CID 140930200) has the molecular formula C32H55NO5 and a molecular weight of 533.79 g/mol. Its IUPAC name is [(3S,5S,6S,10R,13S,17S)-3-hydroxy-17-[(2S)-2-hydroxyoctan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] 4-(methylamino)-4-oxobutanoate.
| Compound Name | [(3S,5S,6S,10R,13S,17S)-3-hydroxy-17-[(2S)-2-hydroxyoctan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 140930200 |
| Molecular Formula | C32H55NO5 |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.41 |
| IUPAC Name | [(3S,5S,6S,10R,13S,17S)-3-hydroxy-17-[(2S)-2-hydroxyoctan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] 4-(methylamino)-4-oxobutanoate |
| SMILES | CCCCCC[C@](C)(O)[C@H]1CCC2C3C[C@H](OC(=O)CCC(=O)NC)[C@H]4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H55NO5/c1-6-7-8-9-16-32(4,37)27-11-10-23-22-20-26(38-29(36)13-12-28(35)33-5)25-19-21(34)14-17-30(25,2)24(22)15-18-31(23,27)3/h21-27,34,37H,6-20H2,1-5H3,(H,33,35)/t21-,22?,23?,24?,25+,26-,27-,30+,31-,32-/m0/s1 |
| InChIKey | GPNJHNWPGITTFW-QPDPFAFNSA-N |
| XLogP | 5.78 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|