C29H52O4 — CID 143814584
(3S,5S,6S,10R,13S)-6-(1-hydroxyethoxy)-17-[(2S)-2-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 143814584) has the molecular formula C29H52O4 and a molecular weight of 464.73 g/mol. Its IUPAC name is (3S,5S,6S,10R,13S)-6-(1-hydroxyethoxy)-17-[(2S)-2-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,6S,10R,13S)-6-(1-hydroxyethoxy)-17-[(2S)-2-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 143814584 |
| Molecular Formula | C29H52O4 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | (3S,5S,6S,10R,13S)-6-(1-hydroxyethoxy)-17-[(2S)-2-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@](C)(O)C1CCC2C3C[C@H](OC(C)O)[C@H]4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H52O4/c1-18(2)8-7-13-29(6,32)26-10-9-22-21-17-25(33-19(3)30)24-16-20(31)11-14-27(24,4)23(21)12-15-28(22,26)5/h18-26,30-32H,7-17H2,1-6H3/t19?,20-,21?,22?,23?,24+,25-,26?,27+,28-,29-/m0/s1 |
| InChIKey | CFTYNRLLMYMFKL-OWUZMTLASA-N |
| XLogP | 5.92 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|