C21H21BrO3 — CID 139038198
(1S,2S,3R,5R)-3-(4-bromophenyl)-5-(2-hydroxypropan-2-yl)-2-phenyl-6-oxabicyclo[3.2.0]heptan-7-one (PubChem CID 139038198) has the molecular formula C21H21BrO3 and a molecular weight of 401.30 g/mol. Its IUPAC name is (1S,2S,3R,5R)-3-(4-bromophenyl)-5-(2-hydroxypropan-2-yl)-2-phenyl-6-oxabicyclo[3.2.0]heptan-7-one.
| Compound Name | (1S,2S,3R,5R)-3-(4-bromophenyl)-5-(2-hydroxypropan-2-yl)-2-phenyl-6-oxabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 139038198 |
| Molecular Formula | C21H21BrO3 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (1S,2S,3R,5R)-3-(4-bromophenyl)-5-(2-hydroxypropan-2-yl)-2-phenyl-6-oxabicyclo[3.2.0]heptan-7-one |
| SMILES | CC(C)(O)[C@@]12C[C@@H](c3ccc(Br)cc3)[C@H](c3ccccc3)[C@@H]1C(=O)O2 |
| InChI | InChI=1S/C21H21BrO3/c1-20(2,24)21-12-16(13-8-10-15(22)11-9-13)17(18(21)19(23)25-21)14-6-4-3-5-7-14/h3-11,16-18,24H,12H2,1-2H3/t16-,17-,18+,21+/m0/s1 |
| InChIKey | NDALFHIDZFUKMA-LXGFNABISA-N |
| XLogP | 4.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|