C17H21BrO3 — CID 139043053
methyl (1S,2S,3S,4R)-4-(4-bromophenyl)-1-hydroxy-3-methyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 139043053) has the molecular formula C17H21BrO3 and a molecular weight of 353.26 g/mol. Its IUPAC name is methyl (1S,2S,3S,4R)-4-(4-bromophenyl)-1-hydroxy-3-methyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2S,3S,4R)-4-(4-bromophenyl)-1-hydroxy-3-methyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 139043053 |
| Molecular Formula | C17H21BrO3 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | methyl (1S,2S,3S,4R)-4-(4-bromophenyl)-1-hydroxy-3-methyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1[C@@H](C)[C@H](c2ccc(Br)cc2)C[C@@]1(O)C(=O)OC |
| InChI | InChI=1S/C17H21BrO3/c1-10(2)15-11(3)14(9-17(15,20)16(19)21-4)12-5-7-13(18)8-6-12/h5-8,11,14-15,20H,1,9H2,2-4H3/t11-,14+,15+,17-/m0/s1 |
| InChIKey | MXGWHQMLVKJAQJ-OFSOMGBPSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|