C24H28O3 — CID 86276422
methyl (1R,2R,3R,4S)-1-hydroxy-3-methyl-4-phenyl-2-(4-phenylbut-1-en-2-yl)cyclopentane-1-carboxylate (PubChem CID 86276422) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is methyl (1R,2R,3R,4S)-1-hydroxy-3-methyl-4-phenyl-2-(4-phenylbut-1-en-2-yl)cyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,3R,4S)-1-hydroxy-3-methyl-4-phenyl-2-(4-phenylbut-1-en-2-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86276422 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | methyl (1R,2R,3R,4S)-1-hydroxy-3-methyl-4-phenyl-2-(4-phenylbut-1-en-2-yl)cyclopentane-1-carboxylate |
| SMILES | C=C(CCc1ccccc1)[C@H]1[C@H](C)[C@@H](c2ccccc2)C[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C24H28O3/c1-17(14-15-19-10-6-4-7-11-19)22-18(2)21(20-12-8-5-9-13-20)16-24(22,26)23(25)27-3/h4-13,18,21-22,26H,1,14-16H2,2-3H3/t18-,21+,22+,24-/m1/s1 |
| InChIKey | DWXVGCZRHZEDHY-CMCISMSHSA-N |
| XLogP | 4.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|