C132H114N6O9 — CID 139038594
(3R,4R)-N-benzyl-2-oxo-N-phenyl-4-(phenylmethoxymethyl)-1-tritylazetidine-3-carboxamide (PubChem CID 139038594) has the molecular formula C132H114N6O9 and a molecular weight of 1928.40 g/mol. Its IUPAC name is (3R,4R)-N-benzyl-2-oxo-N-phenyl-4-(phenylmethoxymethyl)-1-tritylazetidine-3-carboxamide.
| Compound Name | (3R,4R)-N-benzyl-2-oxo-N-phenyl-4-(phenylmethoxymethyl)-1-tritylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 139038594 |
| Molecular Formula | C132H114N6O9 |
| Molecular Weight | 1928.40 g/mol |
| Exact Mass | 1926.86 |
| IUPAC Name | (3R,4R)-N-benzyl-2-oxo-N-phenyl-4-(phenylmethoxymethyl)-1-tritylazetidine-3-carboxamide |
| SMILES | O=C([C@@H]1C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1COCc1ccccc1)N(Cc1ccccc1)c1ccccc1.O=C([C@@H]1C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1COCc1ccccc1)N(Cc1ccccc1)c1ccccc1.O=C([C@@H]1C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1COCc1ccccc1)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C44H38N2O3/c3*47-42(45(39-29-17-6-18-30-39)31-34-19-7-1-8-20-34)41-40(33-49-32-35-21-9-2-10-22-35)46(43(41)48)44(36-23-11-3-12-24-36,37-25-13-4-14-26-37)38-27-15-5-16-28-38/h3*1-30,40-41H,31-33H2/t3*40-,41+/m000/s1 |
| InChIKey | FGULXYUUXUEVBS-ZCRMIJBISA-N |
| XLogP | 24.77 |
| TPSA | 149.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 147 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1928.40 |
| LogP ≤ 5 | 24.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|