C44H38N2O3 — CID 140665468
(3R)-N-benzyl-2-(oxomethylidene)-N-phenyl-4-phenylmethoxy-3-(tritylamino)butanamide (PubChem CID 140665468) has the molecular formula C44H38N2O3 and a molecular weight of 642.80 g/mol. Its IUPAC name is (3R)-N-benzyl-2-(oxomethylidene)-N-phenyl-4-phenylmethoxy-3-(tritylamino)butanamide.
| Compound Name | (3R)-N-benzyl-2-(oxomethylidene)-N-phenyl-4-phenylmethoxy-3-(tritylamino)butanamide |
|---|---|
| PubChem CID | 140665468 |
| Molecular Formula | C44H38N2O3 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | (3R)-N-benzyl-2-(oxomethylidene)-N-phenyl-4-phenylmethoxy-3-(tritylamino)butanamide |
| SMILES | O=C=C(C(=O)N(Cc1ccccc1)c1ccccc1)[C@H](COCc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H38N2O3/c47-32-41(43(48)46(40-29-17-6-18-30-40)31-35-19-7-1-8-20-35)42(34-49-33-36-21-9-2-10-22-36)45-44(37-23-11-3-12-24-37,38-25-13-4-14-26-38)39-27-15-5-16-28-39/h1-30,42,45H,31,33-34H2/t42-/m0/s1 |
| InChIKey | GBBAKISYMLIFEP-WBCKFURZSA-N |
| XLogP | 8.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|