C37H27N7S2 — CID 139038661
2-[7-(4-hexylphenyl)-10-(1,2,2-tricyanoethenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]ethene-1,1,2-tricarbonitrile;toluene (PubChem CID 139038661) has the molecular formula C37H27N7S2 and a molecular weight of 633.81 g/mol. Its IUPAC name is 2-[7-(4-hexylphenyl)-10-(1,2,2-tricyanoethenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]ethene-1,1,2-tricarbonitrile;toluene.
| Compound Name | 2-[7-(4-hexylphenyl)-10-(1,2,2-tricyanoethenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]ethene-1,1,2-tricarbonitrile;toluene |
|---|---|
| PubChem CID | 139038661 |
| Molecular Formula | C37H27N7S2 |
| Molecular Weight | 633.81 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | 2-[7-(4-hexylphenyl)-10-(1,2,2-tricyanoethenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]ethene-1,1,2-tricarbonitrile;toluene |
| SMILES | CCCCCCc1ccc(-n2c3cc(C(C#N)=C(C#N)C#N)sc3c3sc(C(C#N)=C(C#N)C#N)cc32)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C30H19N7S2.C7H8/c1-2-3-4-5-6-19-7-9-22(10-8-19)37-25-11-27(23(17-35)20(13-31)14-32)38-29(25)30-26(37)12-28(39-30)24(18-36)21(15-33)16-34;1-7-5-3-2-4-6-7/h7-12H,2-6H2,1H3;2-6H,1H3 |
| InChIKey | ZDPXFITZSQQDPB-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 147.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.81 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|