C54H84Br2N2O6Si2 — CID 139038783
tert-butyl N-[(1R,2S,3R,4R)-3-bromo-4-methoxy-2-[2-tri(propan-2-yl)silylethynyl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate (PubChem CID 139038783) has the molecular formula C54H84Br2N2O6Si2 and a molecular weight of 1073.25 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3R,4R)-3-bromo-4-methoxy-2-[2-tri(propan-2-yl)silylethynyl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3R,4R)-3-bromo-4-methoxy-2-[2-tri(propan-2-yl)silylethynyl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 139038783 |
| Molecular Formula | C54H84Br2N2O6Si2 |
| Molecular Weight | 1073.25 g/mol |
| Exact Mass | 1070.42 |
| IUPAC Name | tert-butyl N-[(1R,2S,3R,4R)-3-bromo-4-methoxy-2-[2-tri(propan-2-yl)silylethynyl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
| SMILES | CO[C@@H]1c2ccccc2[C@H](NC(=O)OC(C)(C)C)C(C#C[Si](C(C)C)(C(C)C)C(C)C)[C@H]1Br.CO[C@@H]1c2ccccc2[C@H](NC(=O)OC(C)(C)C)C(C#C[Si](C(C)C)(C(C)C)C(C)C)[C@H]1Br |
| InChI | InChI=1S/2C27H42BrNO3Si/c2*1-17(2)33(18(3)4,19(5)6)16-15-22-23(28)25(31-10)21-14-12-11-13-20(21)24(22)29-26(30)32-27(7,8)9/h2*11-14,17-19,22-25H,1-10H3,(H,29,30)/t2*22?,23-,24+,25-/m11/s1 |
| InChIKey | QYGJZOWHFGCEIM-WXQLUIRCSA-N |
| XLogP | 15.11 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.25 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|