C18H14N4O2 — CID 139038977
benzene-1,3-diol;bis(pyridine-4-carbonitrile) (PubChem CID 139038977) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is benzene-1,3-diol;bis(pyridine-4-carbonitrile).
| Compound Name | benzene-1,3-diol;bis(pyridine-4-carbonitrile) |
|---|---|
| PubChem CID | 139038977 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | benzene-1,3-diol;bis(pyridine-4-carbonitrile) |
| SMILES | N#Cc1ccncc1.N#Cc1ccncc1.Oc1cccc(O)c1 |
| InChI | InChI=1S/2C6H4N2.C6H6O2/c2*7-5-6-1-3-8-4-2-6;7-5-2-1-3-6(8)4-5/h2*1-4H;1-4,7-8H |
| InChIKey | JSZUZXIUOPXKIU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |