C48H56N4O4 — CID 139039287
2-[[(2-hydroxy-3,5-dimethylphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-4,6-dimethylphenol (PubChem CID 139039287) has the molecular formula C48H56N4O4 and a molecular weight of 753.00 g/mol. Its IUPAC name is 2-[[(2-hydroxy-3,5-dimethylphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-4,6-dimethylphenol.
| Compound Name | 2-[[(2-hydroxy-3,5-dimethylphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 139039287 |
| Molecular Formula | C48H56N4O4 |
| Molecular Weight | 753.00 g/mol |
| Exact Mass | 752.43 |
| IUPAC Name | 2-[[(2-hydroxy-3,5-dimethylphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(CN(Cc2ccccn2)Cc2cc(C)cc(C)c2O)c1.Cc1cc(C)c(O)c(CN(Cc2ccccn2)Cc2cc(C)cc(C)c2O)c1 |
| InChI | InChI=1S/2C24H28N2O2/c2*1-16-9-18(3)23(27)20(11-16)13-26(15-22-7-5-6-8-25-22)14-21-12-17(2)10-19(4)24(21)28/h2*5-12,27-28H,13-15H2,1-4H3 |
| InChIKey | XCFGYVKSKJILQP-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.00 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|