C20H24F12N2O2P2 — CID 139039988
1,2-dimethoxybenzene;1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium;dihexafluorophosphate (PubChem CID 139039988) has the molecular formula C20H24F12N2O2P2 and a molecular weight of 614.35 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium;dihexafluorophosphate.
| Compound Name | 1,2-dimethoxybenzene;1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium;dihexafluorophosphate |
|---|---|
| PubChem CID | 139039988 |
| Molecular Formula | C20H24F12N2O2P2 |
| Molecular Weight | 614.35 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | 1,2-dimethoxybenzene;1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium;dihexafluorophosphate |
| SMILES | COc1ccccc1OC.C[n+]1ccc(-c2cc[n+](C)cc2)cc1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C12H14N2.C8H10O2.2F6P/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12;1-9-7-5-3-4-6-8(7)10-2;2*1-7(2,3,4,5)6/h3-10H,1-2H3;3-6H,1-2H3;;/q+2;;2*-1 |
| InChIKey | CYWLESXLQJJYJN-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.35 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|