C27H22N2 — CID 139040206
4,7-bis(4-methylphenyl)-2-phenyl-1H-benzimidazole (PubChem CID 139040206) has the molecular formula C27H22N2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 4,7-bis(4-methylphenyl)-2-phenyl-1H-benzimidazole.
| Compound Name | 4,7-bis(4-methylphenyl)-2-phenyl-1H-benzimidazole |
|---|---|
| PubChem CID | 139040206 |
| Molecular Formula | C27H22N2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4,7-bis(4-methylphenyl)-2-phenyl-1H-benzimidazole |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C)cc3)c3[nH]c(-c4ccccc4)nc23)cc1 |
| InChI | InChI=1S/C27H22N2/c1-18-8-12-20(13-9-18)23-16-17-24(21-14-10-19(2)11-15-21)26-25(23)28-27(29-26)22-6-4-3-5-7-22/h3-17H,1-2H3,(H,28,29) |
| InChIKey | UJGFKBYZDVSTQZ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |