C24H23BrN2O6 — CID 139040208
ethyl (E,4S,5R)-5-[(5-bromo-1H-indol-3-yl)methyl]-4-(3-methoxyphenyl)-3-nitro-6-oxohex-2-enoate (PubChem CID 139040208) has the molecular formula C24H23BrN2O6 and a molecular weight of 515.36 g/mol. Its IUPAC name is ethyl (E,4S,5R)-5-[(5-bromo-1H-indol-3-yl)methyl]-4-(3-methoxyphenyl)-3-nitro-6-oxohex-2-enoate.
| Compound Name | ethyl (E,4S,5R)-5-[(5-bromo-1H-indol-3-yl)methyl]-4-(3-methoxyphenyl)-3-nitro-6-oxohex-2-enoate |
|---|---|
| PubChem CID | 139040208 |
| Molecular Formula | C24H23BrN2O6 |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | ethyl (E,4S,5R)-5-[(5-bromo-1H-indol-3-yl)methyl]-4-(3-methoxyphenyl)-3-nitro-6-oxohex-2-enoate |
| SMILES | CCOC(=O)/C=C(\[C@H](c1cccc(OC)c1)[C@H](C=O)Cc1c[nH]c2ccc(Br)cc12)[N+](=O)[O-] |
| InChI | InChI=1S/C24H23BrN2O6/c1-3-33-23(29)12-22(27(30)31)24(15-5-4-6-19(10-15)32-2)17(14-28)9-16-13-26-21-8-7-18(25)11-20(16)21/h4-8,10-14,17,24,26H,3,9H2,1-2H3/b22-12+/t17-,24+/m0/s1 |
| InChIKey | MXHCYWDWVWGGFP-WUPKTGBPSA-N |
| XLogP | 4.80 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|