C34H38BF13N6 — CID 139040215
[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-[5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)tetrazol-1-yl]boranuide (PubChem CID 139040215) has the molecular formula C34H38BF13N6 and a molecular weight of 788.51 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-[5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)tetrazol-1-yl]boranuide.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-[5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)tetrazol-1-yl]boranuide |
|---|---|
| PubChem CID | 139040215 |
| Molecular Formula | C34H38BF13N6 |
| Molecular Weight | 788.51 g/mol |
| Exact Mass | 788.30 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-[5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)tetrazol-1-yl]boranuide |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[BH2-]n1nnnc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H38BF13N6/c1-17(2)21-11-9-12-22(18(3)4)25(21)52-15-16-53(26-23(19(5)6)13-10-14-24(26)20(7)8)28(52)35-54-27(49-50-51-54)29(36,37)30(38,39)31(40,41)32(42,43)33(44,45)34(46,47)48/h9-20H,35H2,1-8H3 |
| InChIKey | UPEMVMQXWFXGST-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.51 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|