C33H48BF3N2O3S — CID 139100639
[1,3-bis[2,6-di(propan-2-yl)phenyl]-2-methylimidazol-1-ium-4-yl]-diethyl-(trifluoromethylsulfonyloxy)boranuide (PubChem CID 139100639) has the molecular formula C33H48BF3N2O3S and a molecular weight of 620.63 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]-2-methylimidazol-1-ium-4-yl]-diethyl-(trifluoromethylsulfonyloxy)boranuide.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]-2-methylimidazol-1-ium-4-yl]-diethyl-(trifluoromethylsulfonyloxy)boranuide |
|---|---|
| PubChem CID | 139100639 |
| Molecular Formula | C33H48BF3N2O3S |
| Molecular Weight | 620.63 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]-2-methylimidazol-1-ium-4-yl]-diethyl-(trifluoromethylsulfonyloxy)boranuide |
| SMILES | CC[B-](CC)(OS(=O)(=O)C(F)(F)F)c1c[n+](-c2c(C(C)C)cccc2C(C)C)c(C)n1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C33H48BF3N2O3S/c1-12-34(13-2,42-43(40,41)33(35,36)37)30-20-38(31-26(21(3)4)16-14-17-27(31)22(5)6)25(11)39(30)32-28(23(7)8)18-15-19-29(32)24(9)10/h14-24H,12-13H2,1-11H3 |
| InChIKey | IDHXAVLEZVFAEX-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.63 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|