C42H64O8S2Si2 — CID 139040252
(1S,3aS,4S,7aS)-7a-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5-hexahydroinden-1-ol (PubChem CID 139040252) has the molecular formula C42H64O8S2Si2 and a molecular weight of 817.27 g/mol. Its IUPAC name is (1S,3aS,4S,7aS)-7a-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5-hexahydroinden-1-ol.
| Compound Name | (1S,3aS,4S,7aS)-7a-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5-hexahydroinden-1-ol |
|---|---|
| PubChem CID | 139040252 |
| Molecular Formula | C42H64O8S2Si2 |
| Molecular Weight | 817.27 g/mol |
| Exact Mass | 816.36 |
| IUPAC Name | (1S,3aS,4S,7aS)-7a-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5-hexahydroinden-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC=C[C@@]2(S(=O)(=O)c3ccccc3)[C@@H](O)CC[C@@H]12.CC(C)(C)[Si](C)(C)O[C@H]1CC=C[C@@]2(S(=O)(=O)c3ccccc3)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/2C21H32O4SSi/c2*1-20(2,3)27(4,5)25-18-12-9-15-21(17(18)13-14-19(21)22)26(23,24)16-10-7-6-8-11-16/h2*6-11,15,17-19,22H,12-14H2,1-5H3/t2*17-,18-,19-,21-/m00/s1 |
| InChIKey | SAALKHJCFDVYEE-CBGPCVIWSA-N |
| XLogP | 8.64 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.27 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|