C21H32O4SSi — CID 102294082
(1S,3aS,4S,7aS)-7a-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5-hexahydroinden-1-ol (PubChem CID 102294082) has the molecular formula C21H32O4SSi and a molecular weight of 408.64 g/mol. Its IUPAC name is (1S,3aS,4S,7aS)-7a-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5-hexahydroinden-1-ol.
| Compound Name | (1S,3aS,4S,7aS)-7a-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5-hexahydroinden-1-ol |
|---|---|
| PubChem CID | 102294082 |
| Molecular Formula | C21H32O4SSi |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (1S,3aS,4S,7aS)-7a-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5-hexahydroinden-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC=C[C@@]2(S(=O)(=O)c3ccccc3)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C21H32O4SSi/c1-20(2,3)27(4,5)25-18-12-9-15-21(17(18)13-14-19(21)22)26(23,24)16-10-7-6-8-11-16/h6-11,15,17-19,22H,12-14H2,1-5H3/t17-,18-,19-,21-/m0/s1 |
| InChIKey | XCNMVNYFUYLIKH-IWFBPKFRSA-N |
| XLogP | 4.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|