C21H36O4SSi — CID 101200594
(1R,4R,5S)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylcycloheptan-1-ol (PubChem CID 101200594) has the molecular formula C21H36O4SSi and a molecular weight of 412.67 g/mol. Its IUPAC name is (1R,4R,5S)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylcycloheptan-1-ol.
| Compound Name | (1R,4R,5S)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylcycloheptan-1-ol |
|---|---|
| PubChem CID | 101200594 |
| Molecular Formula | C21H36O4SSi |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (1R,4R,5S)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylcycloheptan-1-ol |
| SMILES | CC1C(S(=O)(=O)c2ccccc2)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]1O |
| InChI | InChI=1S/C21H36O4SSi/c1-15-18(22)13-14-19(25-27(6,7)21(3,4)5)16(2)20(15)26(23,24)17-11-9-8-10-12-17/h8-12,15-16,18-20,22H,13-14H2,1-7H3/t15?,16-,18-,19+,20?/m1/s1 |
| InChIKey | XXMAAXRLYNBGCU-URVUZCHPSA-N |
| XLogP | 4.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|