C23H34O4SSi — CID 10025953
2-(benzenesulfonyl)-1-[2-[(3E)-hexa-3,5-dienyl]-4-trimethylsilyloxycyclohex-3-en-1-yl]ethanol (PubChem CID 10025953) has the molecular formula C23H34O4SSi and a molecular weight of 434.67 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[2-[(3E)-hexa-3,5-dienyl]-4-trimethylsilyloxycyclohex-3-en-1-yl]ethanol.
| Compound Name | 2-(benzenesulfonyl)-1-[2-[(3E)-hexa-3,5-dienyl]-4-trimethylsilyloxycyclohex-3-en-1-yl]ethanol |
|---|---|
| PubChem CID | 10025953 |
| Molecular Formula | C23H34O4SSi |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[2-[(3E)-hexa-3,5-dienyl]-4-trimethylsilyloxycyclohex-3-en-1-yl]ethanol |
| SMILES | C=C/C=C/CCC1C=C(O[Si](C)(C)C)CCC1C(O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H34O4SSi/c1-5-6-7-9-12-19-17-20(27-29(2,3)4)15-16-22(19)23(24)18-28(25,26)21-13-10-8-11-14-21/h5-8,10-11,13-14,17,19,22-24H,1,9,12,15-16,18H2,2-4H3/b7-6+ |
| InChIKey | ZRLIVJWBCRATQW-VOTSOKGWSA-N |
| XLogP | 5.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|