C13H16O4 — CID 139040734
(3S,8R)-3,13-dimethyl-2,4,12-trioxatricyclo[8.4.0.03,8]tetradeca-1(10),13-dien-11-one (PubChem CID 139040734) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3S,8R)-3,13-dimethyl-2,4,12-trioxatricyclo[8.4.0.03,8]tetradeca-1(10),13-dien-11-one.
| Compound Name | (3S,8R)-3,13-dimethyl-2,4,12-trioxatricyclo[8.4.0.03,8]tetradeca-1(10),13-dien-11-one |
|---|---|
| PubChem CID | 139040734 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (3S,8R)-3,13-dimethyl-2,4,12-trioxatricyclo[8.4.0.03,8]tetradeca-1(10),13-dien-11-one |
| SMILES | Cc1cc2c(c(=O)o1)C[C@H]1CCCO[C@@]1(C)O2 |
| InChI | InChI=1S/C13H16O4/c1-8-6-11-10(12(14)16-8)7-9-4-3-5-15-13(9,2)17-11/h6,9H,3-5,7H2,1-2H3/t9-,13+/m1/s1 |
| InChIKey | ONMKCKTUEGKZMT-RNCFNFMXSA-N |
| XLogP | 2.03 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |