C14H18O4 — CID 139093733
(1S,10S)-1,5-dimethyl-2,6,15-trioxatricyclo[8.5.0.03,8]pentadeca-3(8),4-dien-7-one (PubChem CID 139093733) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (1S,10S)-1,5-dimethyl-2,6,15-trioxatricyclo[8.5.0.03,8]pentadeca-3(8),4-dien-7-one.
| Compound Name | (1S,10S)-1,5-dimethyl-2,6,15-trioxatricyclo[8.5.0.03,8]pentadeca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 139093733 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (1S,10S)-1,5-dimethyl-2,6,15-trioxatricyclo[8.5.0.03,8]pentadeca-3(8),4-dien-7-one |
| SMILES | Cc1cc2c(c(=O)o1)C[C@@H]1CCCCO[C@@]1(C)O2 |
| InChI | InChI=1S/C14H18O4/c1-9-7-12-11(13(15)17-9)8-10-5-3-4-6-16-14(10,2)18-12/h7,10H,3-6,8H2,1-2H3/t10-,14-/m0/s1 |
| InChIKey | AUXAHSMCIFPDQV-HZMBPMFUSA-N |
| XLogP | 2.42 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |