C17H30O4 — CID 143399776
ethane;methyl 5-ethoxy-5-methoxy-4,4a,6,7,8,8a-hexahydro-3H-naphthalene-1-carboxylate (PubChem CID 143399776) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is ethane;methyl 5-ethoxy-5-methoxy-4,4a,6,7,8,8a-hexahydro-3H-naphthalene-1-carboxylate.
| Compound Name | ethane;methyl 5-ethoxy-5-methoxy-4,4a,6,7,8,8a-hexahydro-3H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 143399776 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | ethane;methyl 5-ethoxy-5-methoxy-4,4a,6,7,8,8a-hexahydro-3H-naphthalene-1-carboxylate |
| SMILES | CC.CCOC1(OC)CCCC2C(C(=O)OC)=CCCC21 |
| InChI | InChI=1S/C15H24O4.C2H6/c1-4-19-15(18-3)10-6-8-11-12(14(16)17-2)7-5-9-13(11)15;1-2/h7,11,13H,4-6,8-10H2,1-3H3;1-2H3 |
| InChIKey | WUMBIJZCDSUFAW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|