C60H54N4O2Zn — CID 139041400
zinc bis(2-benzhydryl-4-methyl-6-(1-propan-2-ylbenzimidazol-2-yl)phenolate) (PubChem CID 139041400) has the molecular formula C60H54N4O2Zn and a molecular weight of 928.51 g/mol. Its IUPAC name is zinc bis(2-benzhydryl-4-methyl-6-(1-propan-2-ylbenzimidazol-2-yl)phenolate).
| Compound Name | zinc bis(2-benzhydryl-4-methyl-6-(1-propan-2-ylbenzimidazol-2-yl)phenolate) |
|---|---|
| PubChem CID | 139041400 |
| Molecular Formula | C60H54N4O2Zn |
| Molecular Weight | 928.51 g/mol |
| Exact Mass | 926.35 |
| IUPAC Name | zinc bis(2-benzhydryl-4-methyl-6-(1-propan-2-ylbenzimidazol-2-yl)phenolate) |
| SMILES | Cc1cc(-c2nc3ccccc3n2C(C)C)c([O-])c(C(c2ccccc2)c2ccccc2)c1.Cc1cc(-c2nc3ccccc3n2C(C)C)c([O-])c(C(c2ccccc2)c2ccccc2)c1.[Zn+2] |
| InChI | InChI=1S/2C30H28N2O.Zn/c2*1-20(2)32-27-17-11-10-16-26(27)31-30(32)25-19-21(3)18-24(29(25)33)28(22-12-6-4-7-13-22)23-14-8-5-9-15-23;/h2*4-20,28,33H,1-3H3;/q;;+2/p-2 |
| InChIKey | ZBXXQCGZZFBQLK-UHFFFAOYSA-L |
| XLogP | 13.69 |
| TPSA | 81.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.51 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|